Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1902(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1902
Peptide sequence	AAP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antihypertensive activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Ala-Ala-Pro

Single-letter amino acid

AAP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	257.28 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.6667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Amaranth seed proteins
Precursor protein	Amaranth glutelins
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.2: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.3: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1 Source.4: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.5: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.8: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.9: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic Source.10: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.11: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.12: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1 Source.13: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.14: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.15: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.16: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.17: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.19: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.20: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.21: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.22: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.23: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.24: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.25: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.26: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.27: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.28: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.29: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.30: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.31: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.32: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.33: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.34: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.35: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.36: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.37: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.38: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.39: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9 Source.40: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.41: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.42: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.43: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.44: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.45: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.46: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.47: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.48: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.49: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3 Source.50: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.51: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.52: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.53: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.54: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.55: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.56: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.57: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.58: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10 Source.59: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.60: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.61: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.62: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.63: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.64: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.65: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.66: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.67: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.68: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.69: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.70: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46 Source.71: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.72: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.73: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.74: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.75: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.76: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.77: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3 Source.78: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.79: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.80: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.81: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.82: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.83: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.84: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.85: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.86: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.87: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.88: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.89: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.90: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog Source.91: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.92: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1 Source.93: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.94: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.95: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.96: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.97: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.98: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.99: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.100: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.101: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.102: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.103: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.104: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.105: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.106: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.107: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.108: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.109: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic Source.110: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.111: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.112: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.113: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.114: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.115: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.116: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.117: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.118: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.119: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.120: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.121: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.122: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.123: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.124: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.125: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.126: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic Source.127: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.128: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.129: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.130: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.131: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.132: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.133: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.134: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.135: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.136: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.137: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.138: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.139: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.140: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.141: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.142: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.143: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.144: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.145: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.146: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.147: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.148: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.149: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.150: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.151: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.152: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.153: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.154: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.155: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.156: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.157: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.158: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.159: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.160: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.161: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.162: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.163: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.164: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.165: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.166: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1 Source.167: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.168: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.169: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.170: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.171: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.172: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.173: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.174: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.175: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.176: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.177: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.178: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.179: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.180: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.181: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.182: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.183: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.184: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.185: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.186: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.187: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.188: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.189: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.190: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.191: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.192: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.193: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.194: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.195: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.196: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.197: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.198: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal Source.199: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF Source.200: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.201: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.202: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.203: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.204: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.205: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.206: DFBPPR1561 ---- Plant proteins ---- Chitinase 4 Source.207: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.208: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.209: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.210: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.211: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.212: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.213: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.214: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.215: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.216: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.217: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.218: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.219: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.220: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.221: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.222: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.223: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.224: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29 Source.225: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic Source.226: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.227: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.228: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.229: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.230: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.231: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.232: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.233: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.234: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.235: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.236: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.237: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.238: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.239: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.240: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.241: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.242: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.243: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.244: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.245: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.246: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.247: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.248: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.249: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.250: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.251: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.252: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.253: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.254: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a Source.255: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.256: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.257: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.258: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.259: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.260: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.261: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.262: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.263: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.264: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1 Source.265: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.266: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57 Source.267: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.268: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.269: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.270: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.271: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.272: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.273: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.274: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.275: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.276: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.277: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.278: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.279: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.280: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.281: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.282: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.283: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.284: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.285: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic Source.286: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.287: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.288: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.289: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.290: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.291: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.292: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.293: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.294: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.295: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.296: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.297: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.298: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.299: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.300: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.301: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.302: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.303: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.304: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.305: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.306: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.307: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.308: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.309: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.310: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2 Source.311: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.312: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.313: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.314: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.315: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.316: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.317: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.318: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.319: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.320: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic Source.321: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.322: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.323: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.324: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.325: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.326: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.327: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.328: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5 Source.329: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.330: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30 Source.331: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.332: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.333: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.334: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.335: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.336: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.337: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.338: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.339: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.340: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.341: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.342: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic Source.343: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.344: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.345: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.346: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.347: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.348: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.349: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.350: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.351: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial Source.352: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.353: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.354: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.355: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.356: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.357: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.358: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.359: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6 Source.360: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.361: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.362: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.363: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.364: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.365: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.366: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.367: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic Source.368: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.369: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.370: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.371: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1 Source.372: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.373: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.374: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.375: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1 Source.376: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.377: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.378: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.379: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.380: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.381: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.382: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.383: DFBPPR2137 ---- Plant proteins ---- Metallothionein-like protein 2C Source.384: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.385: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.386: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.387: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.388: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.389: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.390: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial Source.391: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.392: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.393: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.394: DFBPPR2226 ---- Plant proteins ---- Two-component response regulator ORR7 Source.395: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.396: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.397: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic Source.398: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.399: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.400: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.401: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.402: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.403: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.404: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.405: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.406: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.407: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.408: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.409: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B Source.410: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.411: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.412: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.413: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b Source.414: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5 Source.415: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.416: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.417: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic Source.418: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3 Source.419: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.420: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.421: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.422: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.423: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.424: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A Source.425: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.426: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.427: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.428: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.429: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.430: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.431: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.432: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.433: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.434: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.435: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.436: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.437: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.438: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.439: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.440: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.441: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.442: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.443: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.444: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.445: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.446: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.447: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.448: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.449: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.450: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1 Source.451: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.452: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.453: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.454: DFBPPR2462 ---- Plant proteins ---- Arabinogalactan peptide 1 Source.455: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.456: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.457: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.458: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.459: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.460: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.461: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.462: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.463: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4 Source.464: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.465: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.466: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.467: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2 Source.468: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.469: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.470: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.471: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.472: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.473: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.474: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic Source.475: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.476: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.477: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.478: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.479: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.480: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20 Source.481: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.482: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.483: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.484: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.485: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic Source.486: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.487: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.488: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.489: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.490: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.491: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.492: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.493: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.494: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.495: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.496: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.497: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.498: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.499: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.500: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.501: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal Source.502: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.503: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.504: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.505: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.506: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.507: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.508: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.509: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.510: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.511: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.512: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.513: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.514: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.515: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.516: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.517: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.518: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.519: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.520: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.521: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4 Source.522: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.523: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.524: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.525: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.526: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.527: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.528: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.529: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.530: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.531: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.532: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.533: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.534: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.535: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.536: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.537: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.538: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.539: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.540: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.541: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.542: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.543: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.544: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.545: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.546: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.547: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.548: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.549: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.550: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.551: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.552: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.553: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.554: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.555: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.556: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.557: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.558: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.559: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.560: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.561: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.562: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.563: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.564: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.565: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.566: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.567: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.568: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.569: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.570: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.571: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.572: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.573: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.574: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.575: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.576: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.577: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.578: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.579: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.580: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.581: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.582: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7 Source.583: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.584: DFBPPR2995 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.585: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.586: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.587: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.588: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.589: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.590: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.591: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.592: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.593: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.594: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.595: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.596: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.597: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3 Source.598: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.599: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.600: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.601: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.602: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.603: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.604: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.605: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.606: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.607: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.608: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.609: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.610: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.611: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.612: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.613: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.614: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.615: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.616: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.617: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.618: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.619: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.620: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.621: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.622: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.623: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.624: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.625: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.626: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2 Source.627: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.628: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4 Source.629: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.630: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.631: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.632: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.633: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.634: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.635: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.636: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.637: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.638: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.639: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.640: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.641: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.642: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.643: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.644: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.645: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.646: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.647: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.648: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.649: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.650: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.651: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.652: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.653: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.654: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.655: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.656: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.657: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.658: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.659: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.660: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.661: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.662: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic Source.663: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.664: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.665: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1 Source.666: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.667: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.668: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.669: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.670: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.671: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.672: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.673: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.674: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.675: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.676: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B Source.677: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.678: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.679: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.680: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.681: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.682: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.683: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.684: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18 Source.685: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.686: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.687: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.688: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.689: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.690: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.691: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.692: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.693: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.694: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.695: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.696: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.697: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.698: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.699: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.700: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1 Source.701: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.702: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.703: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.704: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.705: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.706: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.707: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.708: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.709: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.710: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.711: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.712: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.713: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.714: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.715: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.716: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.717: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1 Source.718: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.719: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12 Source.720: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.721: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.722: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.723: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic Source.724: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.725: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.726: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.727: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic Source.728: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.729: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.730: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.731: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2 Source.732: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.733: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.734: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3 Source.735: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.736: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.737: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17 Source.738: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.739: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.740: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1 Source.741: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24 Source.742: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.743: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.744: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.745: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic Source.746: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.747: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.748: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.749: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.750: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.751: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.752: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.753: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.754: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.755: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.756: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.757: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.758: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.759: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.760: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.761: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.762: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic Source.763: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41 Source.764: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.765: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.766: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.767: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.768: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.769: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.770: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.771: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.772: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.773: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.774: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.775: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.776: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12 Source.777: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.778: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.779: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.780: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.781: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2 Source.782: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.783: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16 Source.784: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.785: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.786: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.787: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.788: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.789: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.790: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.791: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.792: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.793: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.794: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.795: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.796: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.797: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.798: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.799: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.800: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.801: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.802: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.803: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.804: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.805: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.806: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10 Source.807: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.808: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.809: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.810: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.811: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.812: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.813: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.814: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8 Source.815: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.816: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.817: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.818: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.819: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.820: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.821: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.822: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10 Source.823: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.824: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.825: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.826: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.827: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.828: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.829: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.830: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3 Source.831: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.832: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.833: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.834: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic Source.835: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.836: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.837: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.838: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.839: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.840: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.841: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.842: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.843: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9 Source.844: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.845: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.846: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5 Source.847: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.848: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.849: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.850: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.851: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.852: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.853: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.854: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.855: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.856: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.857: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.858: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.859: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.860: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.861: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.862: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.863: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.864: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.865: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.866: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.867: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.868: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.869: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.870: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.871: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.872: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.873: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.874: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.875: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.876: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.877: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.878: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.879: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.880: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.881: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.882: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.883: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.884: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.885: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.886: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.887: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.888: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A Source.889: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.890: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog Source.891: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.892: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.893: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3 Source.894: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B Source.895: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic Source.896: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.897: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.898: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.899: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic Source.900: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.901: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.902: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.903: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.904: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.905: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.906: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.907: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.908: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.909: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.910: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4 Source.911: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.912: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.913: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.914: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5 Source.915: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.916: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.917: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.918: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.919: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.920: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.921: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B Source.922: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.923: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.924: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.925: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.926: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.927: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.928: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.929: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.930: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.931: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.932: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.933: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1 Source.934: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.935: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.936: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.937: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.938: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.939: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.940: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.941: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.942: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6 Source.943: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.944: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.945: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5 Source.946: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.947: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.948: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.949: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.950: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2 Source.951: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.952: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.953: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.954: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.955: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.956: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4 Source.957: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.958: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.959: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.960: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.961: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.962: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.963: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.964: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.965: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.966: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.967: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.968: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1 Source.969: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.970: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.971: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.972: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.973: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.974: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.975: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.976: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.977: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14 Source.978: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.979: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.980: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.981: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.982: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5 Source.983: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.984: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.985: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.986: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.987: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.988: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.989: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.990: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.991: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.992: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5 Source.993: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.994: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.995: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.996: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.997: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1 Source.998: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15 Source.999: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.1000: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.1001: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.1002: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.1003: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.1004: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.1005: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9 Source.1006: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.1007: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.1008: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.1009: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.1010: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.1011: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2 Source.1012: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.1013: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A Source.1014: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.1015: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3 Source.1016: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.1017: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.1018: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1019: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.1020: DFBPPR4682 ---- Plant proteins ---- Protein SPIRAL1-like 1 Source.1021: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.1022: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.1023: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44 Source.1024: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1025: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8 Source.1026: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26 Source.1027: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.1028: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.1029: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.1030: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12 Source.1031: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.1032: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160 Source.1033: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.1034: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2 Source.1035: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.1036: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.1037: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9 Source.1038: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8 Source.1039: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.1040: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.1041: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2 Source.1042: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.1043: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 Source.1044: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.1045: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.1046: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.1047: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.1048: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.1049: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.1050: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700 Source.1051: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.1052: DFBPPR4821 ---- Plant proteins ---- Protein SPIRAL1-like 4 Source.1053: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1054: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.1055: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.1056: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.1057: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3 Source.1058: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.1059: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400 Source.1060: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.1061: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.1062: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.1063: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1 Source.1064: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1 Source.1065: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.1066: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1 Source.1067: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.1068: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.1069: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.1070: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.1071: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.1072: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.1073: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.1074: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.1075: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase Source.1076: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.1077: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.1078: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.1079: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.1080: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1 Source.1081: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A Source.1082: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.1083: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.1084: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.1085: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1086: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.1087: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.1088: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.1089: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.1090: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1091: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.1092: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.1093: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.1094: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.1095: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A Source.1096: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1097: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.1098: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1099: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.1100: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1101: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1102: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A Source.1103: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1104: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.1105: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1106: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1107: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.1108: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B Source.1109: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1110: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic Source.1111: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.1112: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA Source.1113: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.1114: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1115: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1116: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1117: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.1118: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1119: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.1120: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.1121: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.1122: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1123: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.1124: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1125: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.1126: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1127: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1128: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.1129: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1130: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.1131: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.1132: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.1133: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.1134: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.1135: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1136: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.1137: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.1138: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1139: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.1140: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.1141: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.1142: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.1143: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.1144: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.1145: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.1146: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1147: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic Source.1148: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1149: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1150: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1151: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.1152: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1153: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1154: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1155: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.1156: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.1157: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.1158: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A Source.1159: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1160: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1161: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.1162: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1163: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.1164: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1165: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.1166: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1167: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.1168: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1169: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1170: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1171: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.1172: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A Source.1173: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1174: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1175: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.1176: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1177: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5 Source.1178: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.1179: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.1180: DFBPPR5654 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.1181: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1182: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.1183: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.1184: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.1185: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.1186: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.1187: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1188: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.1189: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.1190: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.1191: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.1192: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.1193: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.1194: DFBPPR5736 ---- Plant proteins ---- Histone H1 Source.1195: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1196: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.1197: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.1198: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.1199: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1 Source.1200: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.1201: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic Source.1202: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17 Source.1203: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1204: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic Source.1205: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.1206: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.1207: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.1208: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1209: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1210: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.1211: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1212: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.1213: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B Source.1214: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.1215: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1216: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.1217: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1 Source.1218: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1219: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.1220: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.1221: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.1222: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1223: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1224: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.1225: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.1226: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.1227: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.1228: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain Source.1229: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.1230: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1231: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.1232: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1233: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1234: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.1235: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1236: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.1237: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.1238: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.1239: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.1240: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.1241: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1242: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1 Source.1243: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.1244: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1245: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1246: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1247: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1248: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1249: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.1250: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.1251: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.1252: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.1253: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3 Source.1254: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1255: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8 Source.1256: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2 Source.1257: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.1258: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2 Source.1259: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7 Source.1260: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30 Source.1261: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.1262: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.1263: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1 Source.1264: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.1265: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1 Source.1266: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6 Source.1267: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.1268: DFBPPR6159 ---- Plant proteins ---- MFS14 protein Source.1269: DFBPPR6205 ---- Plant proteins ---- Unknown protein from spot 1131 of 2D-PAGE of etiolated coleoptile Source.1270: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1271: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.1272: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1273: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.1274: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1275: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1276: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1277: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.1278: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1279: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1280: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.1281: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1282: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial Source.1283: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.1284: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1285: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.1286: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1287: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.1288: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS Source.1289: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing] Source.1290: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.1291: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.1292: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1293: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1294: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.1295: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206 Source.1296: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1297: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.1298: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.1299: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.1300: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.1301: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1302: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.1303: DFBPPR6599 ---- Plant proteins ---- Unknown protein from spot 115 of 2D-PAGE of thylakoid Source.1304: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein Source.1305: DFBPPR6615 ---- Plant proteins ---- Photosystem I reaction center subunit IV Source.1306: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.1307: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1308: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1309: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.1310: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.1311: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.1312: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1313: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1314: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1315: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.1316: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1 Source.1317: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.1318: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1319: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G Source.1320: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.1321: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.1322: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1323: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.1324: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1325: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1326: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.1327: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.1328: DFBPPR6788 ---- Plant proteins ---- Histone H1 Source.1329: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1330: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta Source.1331: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.1332: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1333: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1334: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.1335: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.1336: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.1337: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1338: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1339: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410 Source.1340: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1341: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1342: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.1343: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1344: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.1345: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein Source.1346: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C Source.1347: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.1348: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1349: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1350: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1351: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1352: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.1353: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.1354: DFBPPR7030 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1355: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.1356: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1357: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1358: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1359: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1360: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic Source.1361: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1362: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1363: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.1364: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1365: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1366: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1367: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.1368: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1369: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.1370: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.1371: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic Source.1372: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha Source.1373: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.1374: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.1375: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.1376: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1377: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1378: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.1379: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1380: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.1381: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.1382: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic Source.1383: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.1384: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.1385: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.1386: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1 Source.1387: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.1388: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3 Source.1389: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4 Source.1390: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2 Source.1391: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1392: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1393: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.1394: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1395: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1396: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.1397: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1398: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.1399: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1400: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.1401: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.1402: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.1403: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1404: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1405: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1406: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1407: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1408: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1409: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.1410: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.1411: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.1412: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1413: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.1414: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1415: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1 Source.1416: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin Source.1417: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1418: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1419: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1420: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.1421: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic Source.1422: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.1423: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1424: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.1425: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.1426: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.1427: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1428: DFBPPR8521 ---- Milk proteins ---- Probetacellulin Source.1429: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.1430: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.1431: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1432: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A Source.1433: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1434: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1435: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha Source.1436: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1437: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A Source.1438: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1439: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1440: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein Source.1441: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1442: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1443: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1444: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1445: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1446: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1447: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1448: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1449: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1450: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1451: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1452: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.1453: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1454: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1455: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1456: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.1457: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.1458: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1459: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1460: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1461: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.1462: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1463: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.1464: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.1465: DFBPPR16180 ---- Animal proteins ---- Orexin Source.1466: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A Source.1467: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1468: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1469: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1470: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1471: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.1472: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.1473: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1474: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.1475: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein Source.1476: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1477: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1478: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone Source.1479: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1480: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1481: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.1482: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1483: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1484: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1485: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1486: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1487: DFBPPR16338 ---- Animal proteins ---- Endothelin-2 Source.1488: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1489: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1490: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1491: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1492: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.1493: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.1494: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1495: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1496: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1497: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.1498: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1499: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1 Source.1500: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1501: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1502: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1503: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.1504: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.1505: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.1506: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein Source.1507: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.1508: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.1509: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.1510: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1511: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.1512: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.1513: DFBPPR16616 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.1514: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.1515: DFBPPR16635 ---- Animal proteins ---- Corticoliberin Source.1516: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1517: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3 Source.1518: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1519: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.1520: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.1521: DFBPPR16704 ---- Animal proteins ---- Retbindin Source.1522: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1523: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.1524: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin Source.1525: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2 Source.1526: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1527: DFBPPR16756 ---- Animal proteins ---- Unknown protein from spot 11 of 2D-PAGE of heart tissue Source.1528: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.1529: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1530: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1531: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.1532: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.1533: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1534: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1535: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.1536: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1537: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1538: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.1539: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.1540: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.1541: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1542: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1543: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain Source.1544: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1545: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.1546: DFBPPR16897 ---- Animal proteins ---- Interleukin-4 Source.1547: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1548: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain Source.1549: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1550: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.1551: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1552: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1553: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1554: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1555: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1556: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1557: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1558: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.1559: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1560: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1561: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1562: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau Source.1563: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.1564: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1565: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1566: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.1567: DFBPPR17047 ---- Animal proteins ---- Neuromodulin Source.1568: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1569: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1570: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated Source.1571: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.1572: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1573: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1574: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1575: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.1576: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1577: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.1578: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1579: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1580: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.1581: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1582: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1583: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1584: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1585: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1586: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.1587: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.1588: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.1589: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.1590: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.1591: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.1592: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.1593: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.1594: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.1595: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1596: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.1597: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1598: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.1599: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1600: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1601: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.1602: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.1603: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.1604: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.1605: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.1606: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1607: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1608: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.1609: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.1610: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1611: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.1612: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.1613: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.1614: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1 Source.1615: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1616: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1617: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1618: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1619: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.1620: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1621: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.1622: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1623: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein Source.1624: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1625: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1626: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.1627: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.1628: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.1629: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.1630: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.1631: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1632: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.1633: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1634: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.1635: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.1636: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.1637: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.1638: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1639: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.1640: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.1641: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1642: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.1643: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.1644: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor Source.1645: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1646: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1647: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1648: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1649: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.1650: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.1651: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1652: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1653: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1654: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.1655: DFBPPR17807 ---- Animal proteins ---- Opticin Source.1656: DFBPPR17810 ---- Animal proteins ---- Histone H1.2 Source.1657: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.1658: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.1659: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B Source.1660: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.1661: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1662: DFBPPR17858 ---- Animal proteins ---- Calsenilin Source.1663: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.1664: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.1665: DFBPPR17875 ---- Animal proteins ---- Brain acid soluble protein 1 Source.1666: DFBPPR17879 ---- Animal proteins ---- Menin Source.1667: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.1668: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.1669: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1670: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein Source.1671: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.1672: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1673: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1674: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1675: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome Source.1676: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1677: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1678: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.1679: DFBPPR17947 ---- Animal proteins ---- Erythropoietin Source.1680: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1681: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.1682: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1683: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.1684: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.1685: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.1686: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1687: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B Source.1688: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.1689: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.1690: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.1691: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.1692: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1693: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.1694: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1695: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1696: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1697: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.1698: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.1699: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1700: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B Source.1701: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.1702: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.1703: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1704: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1705: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1706: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.1707: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1708: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1709: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A Source.1710: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1711: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N Source.1712: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.1713: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1714: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1715: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.1716: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.1717: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.1718: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1719: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.1720: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial Source.1721: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.1722: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1 Source.1723: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.1724: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.1725: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.1726: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1727: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1728: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1729: DFBPPR18339 ---- Animal proteins ---- SPARC Source.1730: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase Source.1731: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.1732: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.1733: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1734: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1735: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.1736: DFBPPR18394 ---- Animal proteins ---- Histone H1.1 Source.1737: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.1738: DFBPPR18396 ---- Animal proteins ---- Corticoliberin Source.1739: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.1740: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.1741: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.1742: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1743: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.1744: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.1745: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.1746: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1747: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1748: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.1749: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1750: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1751: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1752: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.1753: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.1754: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1755: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1756: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.1757: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.1758: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.1759: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.1760: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1 Source.1761: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.1762: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.1763: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.1764: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF Source.1765: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.1766: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.1767: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.1768: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.1769: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1770: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.1771: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.1772: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1773: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1774: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.1775: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.1776: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.1777: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.1778: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1779: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.1780: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1781: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.1782: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.1783: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1784: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1 Source.1785: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.1786: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.1787: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1788: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.1789: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.1790: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.1791: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1792: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3 Source.1793: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1794: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1795: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1796: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1797: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.1798: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1799: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1800: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.1801: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1802: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.1803: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.1804: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1805: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10 Source.1806: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1807: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1808: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1809: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.1810: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1811: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.1812: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.1813: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.1814: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide Source.1815: DFBPPR19004 ---- Animal proteins ---- Histone H1.3 Source.1816: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1817: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.1818: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.1819: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1820: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1821: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.1822: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1823: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.1824: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1825: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.1826: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.1827: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.1828: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.1829: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.1830: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9 Source.1831: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa Source.1832: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.1833: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1834: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.1835: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein Source.1836: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2 Source.1837: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.1838: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.1839: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1840: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1841: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1842: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.1843: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.1844: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.1845: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago Source.1846: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.1847: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1848: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.1849: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.1850: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.1851: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.1852: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1853: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.1854: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.1855: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1856: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.1857: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.1858: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.1859: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.1860: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1861: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.1862: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial Source.1863: DFBPPR19329 ---- Animal proteins ---- CD302 antigen Source.1864: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1865: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.1866: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1867: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3 Source.1868: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1869: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.1870: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.1871: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1872: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.1873: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.1874: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.1875: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial Source.1876: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.1877: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.1878: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1879: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.1880: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1881: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1882: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.1883: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1884: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.1885: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1886: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.1887: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1888: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.1889: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.1890: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1891: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1892: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.1893: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.1894: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2 Source.1895: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1896: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.1897: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1898: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.1899: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.1900: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1901: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1902: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.1903: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1904: DFBPPR19619 ---- Animal proteins ---- PAXIP1-associated glutamate-rich protein 1 Source.1905: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1906: DFBPPR19629 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide FF Source.1907: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.1908: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.1909: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.1910: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.1911: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1912: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.1913: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.1914: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.1915: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.1916: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.1917: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.1918: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1 Source.1919: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1920: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.1921: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.1922: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1923: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1924: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.1925: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.1926: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1927: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4 Source.1928: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.1929: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.1930: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1931: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.1932: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.1933: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1934: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.1935: DFBPPR19844 ---- Animal proteins ---- Prosalusin Source.1936: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1937: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1938: DFBPPR19877 ---- Animal proteins ---- Histone H3-like centromeric protein A Source.1939: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.1940: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1941: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1942: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.1943: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial Source.1944: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial Source.1945: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1946: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.1947: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.1948: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.1949: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1950: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.1951: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.1952: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.1953: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.1954: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.1955: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial Source.1956: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.1957: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.1958: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1 Source.1959: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.1960: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1961: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.1962: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.1963: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Source.1964: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.1965: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.1966: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.1967: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1968: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.1969: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.1970: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.1971: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.1972: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2 Source.1973: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.1974: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.1975: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.1976: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.1977: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8 Source.1978: DFBPPR20224 ---- Animal proteins ---- Sclerostin Source.1979: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase Source.1980: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.1981: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.1982: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1983: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3 Source.1984: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2 Source.1985: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.1986: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.1987: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1988: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.1989: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1990: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.1991: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.1992: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.1993: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.1994: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1995: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial Source.1996: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.1997: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.1998: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.1999: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.2000: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.2001: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.2002: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.2003: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5 Source.2004: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.2005: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.2006: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.2007: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.2008: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.2009: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial Source.2010: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.2011: DFBPPR20510 ---- Animal proteins ---- Josephin-1 Source.2012: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.2013: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.2014: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.2015: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2016: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.2017: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.2018: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.2019: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Source.2020: DFBPPR20566 ---- Animal proteins ---- RecQ-mediated genome instability protein 2 Source.2021: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.2022: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.2023: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2024: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.2025: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1 Source.2026: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog Source.2027: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.2028: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.2029: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2030: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2 Source.2031: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.2032: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.2033: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.2034: DFBPPR20669 ---- Animal proteins ---- D site-binding protein Source.2035: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.2036: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.2037: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.2038: DFBPPR20690 ---- Animal proteins ---- Neurotrimin Source.2039: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.2040: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.2041: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17 Source.2042: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.2043: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2044: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.2045: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog Source.2046: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.2047: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2048: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf Source.2049: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45 Source.2050: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69 Source.2051: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.2052: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.2053: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.2054: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2055: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.2056: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.2057: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.2058: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial Source.2059: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.2060: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.2061: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.2062: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2 Source.2063: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.2064: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2065: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.2066: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.2067: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.2068: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2 Source.2069: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.2070: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3 Source.2071: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.2072: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.2073: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.2074: DFBPPR20973 ---- Animal proteins ---- Growth-regulated protein homolog gamma Source.2075: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial Source.2076: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B Source.2077: DFBPPR21005 ---- Animal proteins ---- Growth-regulated protein homolog beta Source.2078: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A Source.2079: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.2080: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.2081: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.2082: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.2083: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.2084: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.2085: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.2086: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.2087: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.2088: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5 Source.2089: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.2090: DFBPPR21077 ---- Animal proteins ---- Growth-regulated protein homolog alpha Source.2091: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.2092: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.2093: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2094: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1 Source.2095: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.2096: DFBPPR21125 ---- Animal proteins ---- Male-enhanced antigen 1 Source.2097: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.2098: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2099: DFBPPR21140 ---- Animal proteins ---- High mobility group nucleosome-binding domain-containing protein 3 Source.2100: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.2101: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.2102: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.2103: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.2104: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2 Source.2105: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.2106: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial Source.2107: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.2108: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.2109: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.2110: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase Source.2111: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198 Source.2112: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.2113: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.2114: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22 Source.2115: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4 Source.2116: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.2117: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.2118: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58 Source.2119: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.2120: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.2121: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D Source.2122: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18 Source.2123: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3 Source.2124: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.2125: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.2126: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.2127: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2 Source.2128: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.2129: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158 Source.2130: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.2131: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4 Source.2132: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.2133: DFBPPR21374 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 6 homolog Source.2134: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.2135: DFBPPR21376 ---- Animal proteins ---- Calponin-3 Source.2136: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3 Source.2137: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2138: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.2139: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein Source.2140: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.2141: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B Source.2142: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial Source.2143: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.2144: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.2145: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2146: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.2147: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.2148: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.2149: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.2150: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.2151: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.2152: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.2153: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.2154: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.2155: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.2156: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.2157: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2 Source.2158: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.2159: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1 Source.2160: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.2161: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.2162: DFBPPR21528 ---- Animal proteins ---- Vasculin Source.2163: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.2164: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial Source.2165: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.2166: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1 Source.2167: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.2168: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3 Source.2169: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2170: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.2171: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.2172: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6 Source.2173: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2174: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2175: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.2176: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.2177: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19 Source.2178: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2179: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.2180: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.2181: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2182: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.2183: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.2184: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2 Source.2185: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1 Source.2186: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.2187: DFBPPR21728 ---- Animal proteins ---- Galectin-9 Source.2188: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.2189: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.2190: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.2191: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.2192: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS Source.2193: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190 Source.2194: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28 Source.2195: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.2196: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.2197: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B Source.2198: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.2199: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1 Source.2200: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.2201: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.2202: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3 Source.2203: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.2204: DFBPPR21848 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 39 Source.2205: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.2206: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.2207: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.2208: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.2209: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.2210: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11 Source.2211: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.2212: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.2213: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.2214: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.2215: DFBPPR21935 ---- Animal proteins ---- Sentan Source.2216: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.2217: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414 Source.2218: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.2219: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.2220: DFBPPR21989 ---- Animal proteins ---- Morphine-modulating neuropeptide A Source.2221: DFBPPR22006 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7 Source.2222: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.2223: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1 Source.2224: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.2225: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2226: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1 Source.2227: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2228: DFBPPR22063 ---- Animal proteins ---- 60S ribosomal protein L29 Source.2229: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.2230: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.2231: DFBPPR22072 ---- Animal proteins ---- Brain protein I3 Source.2232: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.2233: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4 Source.2234: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.2235: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2236: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.2237: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.2238: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.2239: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.2240: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.2241: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.2242: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.2243: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.2244: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182 Source.2245: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.2246: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.2247: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2 Source.2248: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.2249: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.2250: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.2251: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A Source.2252: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.2253: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.2254: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.2255: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.2256: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2 Source.2257: DFBPPR22266 ---- Animal proteins ---- Vexin Source.2258: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.2259: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B Source.2260: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a Source.2261: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog Source.2262: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B Source.2263: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog Source.2264: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1 Source.2265: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16 Source.2266: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2267: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.2268: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.2269: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2270: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.2271: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.2272: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.2273: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.2274: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247 Source.2275: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog Source.2276: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2277: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474 Source.2278: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog Source.2279: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58 Source.2280: DFBPPR22430 ---- Animal proteins ---- UPF0561 protein C2orf68 homolog Source.2281: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.2282: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4 Source.2283: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.2284: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137 Source.2285: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2286: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223 Source.2287: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.2288: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B Source.2289: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248 Source.2290: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.2291: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.2292: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.2293: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2294: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18 Source.2295: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2296: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.2297: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.2298: DFBPPR22598 ---- Animal proteins ---- UPF0488 protein C8orf33 homolog Source.2299: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog Source.2300: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.2301: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.2302: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.2303: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153 Source.2304: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog Source.2305: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65 Source.2306: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.2307: DFBPPR22697 ---- Animal proteins ---- MORN repeat-containing protein 2 Source.2308: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2 Source.2309: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog Source.2310: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.2311: DFBPPR22732 ---- Animal proteins ---- Uncharacterized protein C3orf22 homolog Source.2312: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog Source.2313: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.2314: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2315: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.2316: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.2317: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2318: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.2319: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.2320: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.2321: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.2322: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A Source.2323: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2324: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.2325: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2326: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.2327: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.2328: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.2329: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2330: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.2331: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain Source.2332: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2333: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.2334: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2335: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.2336: DFBPPR8670 ---- Animal proteins ---- Aurora kinase A Source.2337: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.2338: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2339: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.2340: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.2341: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.2342: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2343: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2344: DFBPPR8694 ---- Animal proteins ---- Spastin Source.2345: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.2346: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein Source.2347: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2348: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.2349: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.2350: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.2351: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.2352: DFBPPR8720 ---- Animal proteins ---- Interleukin-4 Source.2353: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.2354: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2355: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A Source.2356: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.2357: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.2358: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2359: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.2360: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.2361: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2362: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.2363: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2364: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2365: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.2366: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.2367: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.2368: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.2369: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.2370: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2371: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2372: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2373: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.2374: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.2375: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.2376: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.2377: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.2378: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.2379: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.2380: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.2381: DFBPPR9044 ---- Animal proteins ---- Albumin Source.2382: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.2383: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2384: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2385: DFBPPR9076 ---- Animal proteins ---- Histone H1t Source.2386: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.2387: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.2388: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2389: DFBPPR9109 ---- Animal proteins ---- Natriuretic peptides B Source.2390: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1 Source.2391: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2392: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2393: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2 Source.2394: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2395: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.2396: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.2397: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.2398: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.2399: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2400: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2401: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.2402: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.2403: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.2404: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2405: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.2406: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.2407: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.2408: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2409: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.2410: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2411: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1 Source.2412: DFBPPR9338 ---- Animal proteins ---- SPARC Source.2413: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2414: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2415: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2416: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.2417: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.2418: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.2419: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2420: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.2421: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain Source.2422: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.2423: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.2424: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.2425: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.2426: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.2427: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2428: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.2429: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.2430: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.2431: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2432: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2433: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2434: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4 Source.2435: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2436: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.2437: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.2438: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.2439: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2440: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.2441: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.2442: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.2443: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.2444: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.2445: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.2446: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.2447: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2448: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.2449: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.2450: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor Source.2451: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.2452: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2453: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.2454: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase Source.2455: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.2456: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.2457: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.2458: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.2459: DFBPPR9667 ---- Animal proteins ---- Brain and acute leukemia cytoplasmic protein Source.2460: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.2461: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.2462: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.2463: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.2464: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B Source.2465: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2466: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.2467: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.2468: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.2469: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.2470: DFBPPR9812 ---- Animal proteins ---- 60S ribosomal protein L29 Source.2471: DFBPPR9817 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 3 Source.2472: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.2473: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.2474: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2475: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19 Source.2476: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.2477: DFBPPR9871 ---- Animal proteins ---- DNA-binding protein inhibitor ID-4 Source.2478: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2479: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2480: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.2481: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7 Source.2482: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.2483: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2484: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.2485: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.2486: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.2487: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1 Source.2488: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.2489: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.2490: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2491: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.2492: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.2493: DFBPPR10004 ---- Animal proteins ---- Spastin Source.2494: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.2495: DFBPPR10009 ---- Animal proteins ---- Transthyretin Source.2496: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.2497: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.2498: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.2499: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.2500: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.2501: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.2502: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2503: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.2504: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2505: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.2506: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor Source.2507: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.2508: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.2509: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2510: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.2511: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2512: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.2513: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2514: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.2515: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.2516: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.2517: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.2518: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.2519: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.2520: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.2521: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.2522: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2523: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.2524: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2525: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.2526: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2527: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.2528: DFBPPR10187 ---- Animal proteins ---- Myogenin Source.2529: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.2530: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.2531: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2532: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2533: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2534: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1 Source.2535: DFBPPR10218 ---- Animal proteins ---- Occludin Source.2536: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.2537: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.2538: DFBPPR10240 ---- Animal proteins ---- Cerberus Source.2539: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.2540: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.2541: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.2542: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.2543: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.2544: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2545: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.2546: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.2547: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.2548: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2549: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.2550: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.2551: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.2552: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.2553: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.2554: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog Source.2555: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2556: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2557: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2558: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2559: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2560: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.2561: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2562: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.2563: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.2564: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.2565: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.2566: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2567: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.2568: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.2569: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2570: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2571: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2572: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.2573: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2574: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.2575: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.2576: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.2577: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.2578: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2579: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.2580: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2581: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.2582: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2583: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.2584: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2585: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.2586: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.2587: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.2588: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.2589: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.2590: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A Source.2591: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2592: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.2593: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.2594: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2595: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.2596: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.2597: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.2598: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.2599: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2600: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.2601: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2602: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.2603: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2604: DFBPPR10583 ---- Animal proteins ---- Gallinacin-9 Source.2605: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2606: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.2607: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2608: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2609: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2610: DFBPPR10605 ---- Animal proteins ---- Elastin Source.2611: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.2612: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.2613: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.2614: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2615: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2616: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.2617: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.2618: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2619: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2620: DFBPPR10640 ---- Animal proteins ---- Caveolin-1 Source.2621: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.2622: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.2623: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2624: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.2625: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.2626: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.2627: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2628: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.2629: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2630: DFBPPR10688 ---- Animal proteins ---- Protein S100-A6 Source.2631: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.2632: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.2633: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.2634: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2635: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.2636: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.2637: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.2638: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2639: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.2640: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.2641: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.2642: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2643: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.2644: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2645: DFBPPR10738 ---- Animal proteins ---- Histone H1.10 Source.2646: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2647: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.2648: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase Source.2649: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.2650: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2651: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2652: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2653: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.2654: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2655: DFBPPR10790 ---- Animal proteins ---- Histone H1 Source.2656: DFBPPR10794 ---- Animal proteins ---- Zyxin Source.2657: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.2658: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.2659: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.2660: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.2661: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog Source.2662: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2663: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.2664: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2665: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2666: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2667: DFBPPR10877 ---- Animal proteins ---- Histone H1.01 Source.2668: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.2669: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.2670: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.2671: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.2672: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.2673: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L Source.2674: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.2675: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2676: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.2677: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.2678: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.2679: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.2680: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.2681: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2682: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.2683: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.2684: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.2685: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.2686: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.2687: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.2688: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.2689: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.2690: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.2691: DFBPPR11048 ---- Animal proteins ---- Calcitonin Source.2692: DFBPPR11057 ---- Animal proteins ---- Calcitonin gene-related peptide Source.2693: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.2694: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2695: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.2696: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA Source.2697: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2698: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.2699: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1 Source.2700: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1 Source.2701: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.2702: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.2703: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.2704: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2705: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.2706: DFBPPR11151 ---- Animal proteins ---- SPARC Source.2707: DFBPPR11155 ---- Animal proteins ---- Stathmin Source.2708: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.2709: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.2710: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.2711: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.2712: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.2713: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.2714: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.2715: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2716: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.2717: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.2718: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.2719: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.2720: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.2721: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.2722: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.2723: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1 Source.2724: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.2725: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2726: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.2727: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.2728: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.2729: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.2730: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.2731: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.2732: DFBPPR11301 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19 Source.2733: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R Source.2734: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.2735: DFBPPR11308 ---- Animal proteins ---- Histone H1.03 Source.2736: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.2737: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.2738: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A Source.2739: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.2740: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.2741: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.2742: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2743: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.2744: DFBPPR11354 ---- Animal proteins ---- Centromere protein O Source.2745: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2746: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX Source.2747: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.2748: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2749: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2750: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2751: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.2752: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.2753: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.2754: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.2755: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.2756: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1 Source.2757: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.2758: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.2759: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine Source.2760: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2761: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.2762: DFBPPR11538 ---- Animal proteins ---- Non-histone chromosomal protein HMG-17 Source.2763: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.2764: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.2765: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2766: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.2767: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.2768: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.2769: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.2770: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8 Source.2771: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2772: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog Source.2773: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.2774: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.2775: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog Source.2776: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2777: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.2778: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.2779: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2780: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.2781: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.2782: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.2783: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.2784: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.2785: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.2786: DFBPPR11657 ---- Animal proteins ---- Protein BTG1 Source.2787: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.2788: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog Source.2789: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.2790: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2791: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.2792: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.2793: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.2794: DFBPPR11683 ---- Animal proteins ---- Somatostatin Source.2795: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.2796: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.2797: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.2798: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.2799: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2800: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.2801: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2802: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2803: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.2804: DFBPPR11733 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14A Source.2805: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.2806: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.2807: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.2808: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.2809: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38 Source.2810: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15 Source.2811: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein Source.2812: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.2813: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2814: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.2815: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5 Source.2816: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.2817: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.2818: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.2819: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.2820: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2821: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.2822: DFBPPR11822 ---- Animal proteins ---- Inversin Source.2823: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.2824: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.2825: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.2826: DFBPPR11836 ---- Animal proteins ---- Gallinacin-14 Source.2827: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.2828: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.2829: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.2830: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1 Source.2831: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein Source.2832: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2 Source.2833: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.2834: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2835: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.2836: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.2837: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.2838: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.2839: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.2840: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.2841: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.2842: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.2843: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.2844: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2845: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1 Source.2846: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.2847: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.2848: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.2849: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial Source.2850: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.2851: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.2852: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.2853: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.2854: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.2855: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.2856: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.2857: DFBPPR12041 ---- Animal proteins ---- Paladin Source.2858: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1 Source.2859: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.2860: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.2861: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4 Source.2862: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.2863: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2864: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.2865: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2 Source.2866: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.2867: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.2868: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.2869: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic Source.2870: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2871: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.2872: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.2873: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2874: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2875: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A Source.2876: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.2877: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.2878: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.2879: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.2880: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog Source.2881: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.2882: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.2883: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43 Source.2884: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.2885: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog Source.2886: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.2887: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.2888: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2889: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2890: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2891: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.2892: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1 Source.2893: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.2894: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2895: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2896: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.2897: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.2898: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2899: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2900: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.2901: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2902: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain Source.2903: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E Source.2904: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2905: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2906: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.2907: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.2908: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.2909: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.2910: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.2911: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2912: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2913: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2914: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.2915: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C Source.2916: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2917: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.2918: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.2919: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2920: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.2921: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.2922: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.2923: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.2924: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.2925: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.2926: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.2927: DFBPPR12441 ---- Animal proteins ---- Triadin Source.2928: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2929: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.2930: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.2931: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.2932: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.2933: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.2934: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.2935: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.2936: DFBPPR12499 ---- Animal proteins ---- Interleukin-1 alpha Source.2937: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.2938: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2939: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.2940: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2941: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.2942: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.2943: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2944: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2945: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.2946: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.2947: DFBPPR12607 ---- Animal proteins ---- Basigin Source.2948: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2949: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2950: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2951: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2952: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.2953: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2954: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2955: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2956: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2957: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.2958: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.2959: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.2960: DFBPPR12738 ---- Animal proteins ---- Histone H1.4 Source.2961: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.2962: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.2963: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2964: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2965: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.2966: DFBPPR12762 ---- Animal proteins ---- SPARC Source.2967: DFBPPR12772 ---- Animal proteins ---- Colipase Source.2968: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.2969: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2970: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.2971: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2972: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.2973: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.2974: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.2975: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.2976: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2977: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.2978: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.2979: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.2980: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.2981: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.2982: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2983: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.2984: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.2985: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.2986: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.2987: DFBPPR12935 ---- Animal proteins ---- Histone H1.3 Source.2988: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2989: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.2990: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12 Source.2991: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.2992: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.2993: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.2994: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.2995: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2996: DFBPPR13024 ---- Animal proteins ---- Erythropoietin Source.2997: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.2998: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta Source.2999: DFBPPR13051 ---- Animal proteins ---- Permeability factor 2 Source.3000: DFBPPR13060 ---- Animal proteins ---- Growth-regulated protein homolog Source.3001: DFBPPR13083 ---- Animal proteins ---- Promotilin Source.3002: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3003: DFBPPR13094 ---- Animal proteins ---- Atherin Source.3004: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.3005: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.3006: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3007: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3008: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain Source.3009: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A Source.3010: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.3011: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.3012: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A Source.3013: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3014: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.3015: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.3016: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated Source.3017: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3018: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.3019: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.3020: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.3021: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1 Source.3022: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.3023: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3024: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.3025: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.3026: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1 Source.3027: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle Source.3028: DFBPPR13348 ---- Animal proteins ---- Calcitonin Source.3029: DFBPPR13358 ---- Animal proteins ---- Erythropoietin Source.3030: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.3031: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.3032: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3033: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.3034: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.3035: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.3036: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau Source.3037: DFBPPR13458 ---- Animal proteins ---- Interleukin-4 Source.3038: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.3039: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.3040: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.3041: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.3042: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.3043: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.3044: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2 Source.3045: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.3046: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3047: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.3048: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain Source.3049: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36 Source.3050: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.3051: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3052: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor Source.3053: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.3054: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II Source.3055: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.3056: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3057: DFBPPR13627 ---- Animal proteins ---- Erythropoietin Source.3058: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.3059: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.3060: DFBPPR13654 ---- Animal proteins ---- Corticoliberin Source.3061: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.3062: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.3063: DFBPPR13670 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin Source.3064: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.3065: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.3066: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.3067: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide Source.3068: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.3069: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A Source.3070: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.3071: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.3072: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.3073: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C Source.3074: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.3075: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B Source.3076: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.3077: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.3078: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain Source.3079: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.3080: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.3081: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.3082: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.3083: DFBPPR13839 ---- Animal proteins ---- Interleukin-4 Source.3084: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.3085: DFBPPR13847 ---- Animal proteins ---- Growth-regulated alpha protein Source.3086: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.3087: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.3088: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.3089: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.3090: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.3091: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.3092: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.3093: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B Source.3094: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15 Source.3095: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide Source.3096: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.3097: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon Source.3098: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.3099: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3100: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.3101: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.3102: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2 Source.3103: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.3104: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.3105: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.3106: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3107: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3108: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.3109: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3110: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.3111: DFBPPR14078 ---- Marine protein ---- Histone H1 Source.3112: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.3113: DFBPPR14090 ---- Marine protein ---- Trypsin-3 Source.3114: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.3115: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.3116: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin Source.3117: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.3118: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.3119: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein Source.3120: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18 Source.3121: DFBPPR14189 ---- Marine protein ---- Protein Flattop Source.3122: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A Source.3123: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B Source.3124: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58 Source.3125: DFBPPR14235 ---- Marine protein ---- Calcitonin-1 Source.3126: DFBPPR14250 ---- Marine protein ---- Vasotocin-neurophysin VT 2 Source.3127: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1 Source.3128: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.3129: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.3130: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3131: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.3132: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.3133: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.3134: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.3135: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.3136: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.3137: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta Source.3138: DFBPPR14559 ---- Marine protein ---- Histone H1 Source.3139: DFBPPR14566 ---- Marine protein ---- Non-histone chromosomal protein H6 Source.3140: DFBPPR14592 ---- Marine protein ---- Intelectin Source.3141: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.3142: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.3143: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.3144: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein Source.3145: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A Source.3146: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B Source.3147: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.3148: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit Source.3149: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit Source.3150: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit Source.3151: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.3152: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.3153: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.3154: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.3155: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.3156: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.3157: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.3158: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.3159: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.3160: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.3161: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.3162: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.3163: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.3164: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.3165: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.3166: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.3167: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1 Source.3168: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6 Source.3169: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.3170: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52 Source.3171: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.3172: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.3173: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.3174: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B Source.3175: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.3176: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.3177: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1 Source.3178: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.3179: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.3180: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.3181: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.3182: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.3183: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.3184: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.3185: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.3186: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone Source.3187: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.3188: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.3189: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.3190: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.3191: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.3192: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.3193: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.3194: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.3195: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.3196: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.3197: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.3198: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.3199: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71 Source.3200: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1 Source.3201: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1 Source.3202: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.3203: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta Source.3204: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6 Source.3205: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.3206: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.3207: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.3208: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.3209: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1 Source.3210: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.3211: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.3212: DFBPPR15646 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 36, mitochondrial Source.3213: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.3214: DFBPPR15671 ---- Microorganism protein ---- Outer spore wall protein 5 Source.3215: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial Source.3216: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.3217: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.3218: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.3219: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial Source.3220: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.3221: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.3222: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.3223: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.3224: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.3225: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.3226: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.3227: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.3228: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.3229: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.3230: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.3231: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.3232: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.3233: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.3234: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.3235: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.3236: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.3237: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.3238: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3239: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.3240: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.3241: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic Source.3242: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.3243: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.3244: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3245: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.3246: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3247: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.3248: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2 Source.3249: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1 Source.3250: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.3251: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.3252: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3253: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.3254: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.3255: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.3256: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.3257: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.3258: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1 Source.3259: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.3260: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.3261: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.3262: DFBPPR7970 ---- Plant protein ---- Subtilisin inhibitor Source.3263: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A Source.3264: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3265: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.3266: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.3267: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.3268: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3269: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3270: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.3271: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.3272: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3273: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.3274: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.3275: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3276: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10 Source.3277: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3278: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.3279: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1 Source.3280: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3 Source.3281: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Link-research Inductive analysis	Link 1: DFBPACEI1312----Iberian dry-cured ham----Iberian dry-cured ham extract Link 2: DFBPACEI0468----Bovine milk protein----Lactoferrin, Lactotransferrin

Biological/Functional activity & target protein

ACE-inhibitory activity	Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide AAP was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC₅₀ value was determined in this study).
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	No prediction can be made about the peptide bitterness. ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references

DFBP

[D1]	DFBPANHY0162
[D2]	DFBPMUFU0318

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11. PMID: 20435155 DOI: 10.1016/j.niox.2010.04.006
Other literature(s)	[1] Casokinins as bioactive peptides in the primary strucure of casein. In: Food proteins, structure and functionality ed Schwenke K.D., Mothes R., VCh, Weinheim - New York - Basel - Cambridge - Tokyo, pp 67-75.
PubDate	2010