E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0262(Multifunctional peptide)
DFBP ID DFBPMUFU0262
Peptide sequence YYA
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1224 Jellyfish (Stomolophus nomurai) Jellyfish powder

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0684 Jellyfish (Stomolophus nomurai) Jellyfish powder

N.D

Physical & computational properties
Three-letter amino acid Tyr-Tyr-Ala
Single-letter amino acid YYA
Peptide length 3
Theoretical mass 415.44 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.87 c
GRAVY -0.2667
Hydrophilic residue ratio 33.33%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.3: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.4: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.5: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.6: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.7: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.8: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.9: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.10: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.11: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.12: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.13: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.14: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.15: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.16: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.17: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.18: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.19: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.20: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.21: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.22: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.23: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.24: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.25: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.26: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.27: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.28: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.29: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.30: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.31: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.32: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.33: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.34: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.35: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.36: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.37: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.38: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.39: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.40: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.41: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.42: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.43: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.44: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.45: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.46: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.47: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.48: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.49: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.50: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.51: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.52: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.53: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.54: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.55: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.56: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.57: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.58: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.59: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.60: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.61: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.62: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.63: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.64: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.65: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.66: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.67: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.68: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.69: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.70: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.71: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.72: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.73: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.74: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.75: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.76: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.77: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.78: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.79: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.80: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.81: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.82: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.83: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.84: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.85: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.86: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.87: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.88: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.89: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.90: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.91: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.92: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.93: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.94: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.95: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.96: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.97: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.98: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.99: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.100: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.101: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.102: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.103: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.104: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.105: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.106: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.107: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.108: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.109: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.110: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.111: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.112: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.113: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.114: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.115: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.116: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.117: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.118: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.119: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.120: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.121: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.122: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.123: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.124: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.125: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.126: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.127: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.128: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.129: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.130: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.131: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.132: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.133: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.134: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.135: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.136: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.137: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.138: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.139: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.140: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.141: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.142: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.143: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.144: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.145: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.146: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.147: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.148: DFBPPR4790 ---- Plant proteins ---- 60S ribosomal protein L30
Source.149: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.150: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.151: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.152: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.153: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.154: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.155: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.156: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.157: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.158: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit
Source.159: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.160: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.161: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.162: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.163: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.164: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.165: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.166: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.167: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.168: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.169: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.170: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.171: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.172: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.173: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.174: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.175: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.176: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.177: DFBPPR6152 ---- Plant proteins ---- 60S ribosomal protein L30
Source.178: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.179: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.180: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.181: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.182: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.183: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.184: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.185: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.186: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.187: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.188: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.189: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.190: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.191: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.192: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.193: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.194: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.195: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.196: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.197: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.198: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.199: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.200: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.201: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.202: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.203: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.204: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.205: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.206: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.207: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.208: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.209: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.210: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.211: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.212: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.213: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.214: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.215: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.216: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.217: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.218: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.219: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.220: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.221: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.222: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.223: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.224: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.225: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.226: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.227: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.228: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.229: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.230: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.231: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.232: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.233: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.234: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.235: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator
Source.236: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.237: DFBPPR16588 ---- Animal proteins ---- Peptide YY
Source.238: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.239: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO
Source.240: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.241: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.242: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.243: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.244: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.245: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.246: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.247: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.248: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.249: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.250: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.251: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.252: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.253: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.254: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.255: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.256: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.257: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.258: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.259: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.260: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.261: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.262: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.263: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.264: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.265: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.266: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.267: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.268: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.269: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.270: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.271: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.272: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.273: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.274: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.275: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.276: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.277: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.278: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.279: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.280: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.281: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.282: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.283: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.284: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.285: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.286: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.287: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.288: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.289: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.290: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.291: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.292: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.293: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.294: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.295: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.296: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.297: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.298: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.299: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.300: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.301: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.302: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.303: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.304: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.305: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.306: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.307: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.308: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.309: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.310: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.311: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.312: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.313: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.314: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase
Source.315: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.316: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.317: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.318: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.319: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.320: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.321: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.322: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.323: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.324: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.325: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.326: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.327: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.328: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.329: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.330: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.331: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.332: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.333: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.334: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.335: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.336: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.337: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.338: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.339: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.340: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1
Source.341: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.342: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.343: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.344: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.345: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.346: DFBPPR22274 ---- Animal proteins ---- 60S ribosomal protein L30
Source.347: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.348: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.349: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.350: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.351: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.352: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.353: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase
Source.354: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.355: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.356: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.357: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.358: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.359: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.360: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.361: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.362: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.363: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.364: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.365: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.366: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.367: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.368: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.369: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.370: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.371: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.372: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.373: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.374: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.375: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.376: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.377: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.378: DFBPPR9367 ---- Animal proteins ---- Peptide YY
Source.379: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.380: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.381: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.382: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.383: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.384: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.385: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.386: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.387: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.388: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.389: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.390: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.391: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.392: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.393: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.394: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.395: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.396: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.397: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.398: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.399: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.400: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.401: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.402: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.403: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.404: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.405: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.406: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.407: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.408: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.409: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.410: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.411: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.412: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.413: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.414: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.415: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.416: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.417: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.418: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.419: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.420: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.421: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.422: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.423: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.424: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.425: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.426: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.427: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.428: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.429: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.430: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.431: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.432: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.433: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.434: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.435: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.436: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.437: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.438: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.439: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.440: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.441: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.442: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.443: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.444: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.445: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.446: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.447: DFBPPR11815 ---- Animal proteins ---- 60S ribosomal protein L30
Source.448: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.449: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.450: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.451: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.452: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.453: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.454: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.455: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.456: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.457: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.458: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.459: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.460: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.461: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.462: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.463: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.464: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.465: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.466: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.467: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.468: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.469: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.470: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.471: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.472: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.473: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.474: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.475: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.476: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.477: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.478: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.479: DFBPPR12933 ---- Animal proteins ---- Peptide YY
Source.480: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.481: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5
Source.482: DFBPPR13084 ---- Animal proteins ---- Ig heavy chain V-A2 region K-25
Source.483: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5
Source.484: DFBPPR13114 ---- Animal proteins ---- Ig heavy chain V-A2 region BS-1
Source.485: DFBPPR13130 ---- Animal proteins ---- Ig kappa chain V region AH80-5
Source.486: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.487: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.488: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.489: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.490: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.491: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.492: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.493: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.494: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.495: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.496: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.497: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.498: DFBPPR13851 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2A
Source.499: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C
Source.500: DFBPPR13949 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2B
Source.501: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.502: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.503: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.504: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.505: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.506: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.507: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.508: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.509: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.510: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.511: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.512: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.513: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.514: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.515: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.516: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.517: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.518: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.519: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.520: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.521: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.522: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.523: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.524: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.525: DFBPPR15281 ---- Microorganism protein ---- Cytochrome c oxidase subunit 9, mitochondrial
Source.526: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.527: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.528: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.529: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.530: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.531: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.532: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.533: DFBPPR15534 ---- Microorganism protein ---- 60S ribosomal protein L30
Source.534: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.535: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.536: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.537: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.538: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.539: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.540: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.541: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.542: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.543: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.544: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.545: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.546: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.547: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.548: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 7939
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214