E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1766(ACE-inhibitory peptide)
DFBP ID DFBPACEI1766
Peptide sequence VEV
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Val-Glu-Val
Single-letter amino acid VEV
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
345.61 Da 345.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
IC50 115.20 uM
pIC50 -2.061
GRAVY 1.6333 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Wheat
Precursor protein Wheat germ
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.2: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.4: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.5: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.6: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.7: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.8: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.10: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.11: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.12: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.13: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.14: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.15: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.16: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.17: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.18: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.19: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.20: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.21: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.22: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.23: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.24: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.25: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.26: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.27: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.28: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.29: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.30: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.31: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.32: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.33: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.34: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.35: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.36: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.37: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.38: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.39: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.40: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.41: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.42: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.43: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.44: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.45: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.46: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.47: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.48: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.49: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.50: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.51: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.52: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.53: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.54: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.55: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.56: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.57: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.58: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.59: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.60: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.61: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.62: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.63: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.64: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.65: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.66: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.67: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.68: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.69: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.70: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.71: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.72: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.73: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.74: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.75: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1
Source.76: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.77: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.78: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.79: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.80: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.81: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.82: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.83: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.84: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.85: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.86: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.87: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.88: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.89: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.90: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.91: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.92: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.93: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.94: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.95: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.96: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.97: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.98: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.99: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.100: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.101: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.102: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.103: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.104: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.105: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.106: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.107: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.108: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.109: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.110: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.111: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.112: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.113: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.114: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.115: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.116: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.117: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.118: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.119: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.120: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.121: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51
Source.122: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein
Source.123: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.124: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.125: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.126: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.127: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.128: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.129: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.130: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.131: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.132: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.133: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.134: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.135: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.136: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.137: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.138: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.139: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.140: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.141: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.142: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.143: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.144: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.145: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.146: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.147: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.148: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.149: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.150: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.151: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.152: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.153: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.154: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.155: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.156: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.157: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.158: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.159: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.160: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.161: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.162: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.163: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.164: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.165: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.166: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.167: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.168: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.169: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.170: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.171: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.172: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.173: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.174: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.175: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.176: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.177: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.178: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.179: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.180: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.181: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.182: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.183: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.184: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.185: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.186: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.187: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.188: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.189: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.190: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.191: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.192: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.193: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.194: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.195: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.196: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.197: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.198: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.199: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.200: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.201: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.202: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.203: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.204: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.205: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.206: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.207: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.208: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.209: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.210: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.211: DFBPPR2223 ---- Plant proteins ---- Urease
Source.212: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.213: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.214: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.215: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.216: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.217: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.218: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.219: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.220: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.221: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.222: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.223: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.224: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.225: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.226: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.227: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.228: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.229: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.230: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.231: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.232: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.233: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.234: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.235: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.236: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.237: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.238: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.239: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.240: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.241: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.242: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.243: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.244: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.245: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.246: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.247: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.248: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.249: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.250: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.251: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.252: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.253: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.254: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.255: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.256: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.257: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.258: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.259: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.260: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.261: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.262: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.263: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.264: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.265: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.266: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.267: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.268: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.269: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.270: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.271: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.272: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.273: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.274: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.275: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.276: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.277: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.278: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.279: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.280: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.281: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.282: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.283: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.284: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.285: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.286: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.287: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.288: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.289: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.290: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.291: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.292: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.293: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.294: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.295: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.296: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.297: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.298: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.299: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.300: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.301: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.302: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.303: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.304: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.305: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.306: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.307: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.308: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.309: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.310: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.311: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.312: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.313: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.314: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.315: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.316: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.317: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.318: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.319: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.320: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.321: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.322: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.323: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.324: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.325: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.326: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.327: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.328: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.329: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.330: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.331: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.332: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.333: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.334: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.335: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.336: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.337: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.338: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.339: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.340: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.341: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.342: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.343: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.344: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.345: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.346: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.347: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.348: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.349: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.350: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.351: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.352: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.353: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.354: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.355: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.356: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.357: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.358: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.359: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.360: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.361: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.362: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.363: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.364: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.365: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.366: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.367: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.368: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.369: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.370: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.371: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.372: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.373: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.374: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.375: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.376: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.377: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.378: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.379: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.380: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.381: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.382: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.383: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.384: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.385: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.386: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.387: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.388: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.389: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.390: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.391: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.392: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.393: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.394: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.395: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.396: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.397: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.398: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.399: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.400: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.401: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.402: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.403: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.404: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.405: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.406: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.407: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.408: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.409: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.410: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.411: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.412: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.413: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.414: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.415: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.416: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.417: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.418: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.419: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.420: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.421: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.422: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.423: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.424: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.425: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.426: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.427: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.428: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.429: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.430: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.431: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.432: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.433: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.434: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.435: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.436: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.437: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.438: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.439: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.440: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.441: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.442: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.443: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.444: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.445: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.446: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.447: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.448: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.449: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.450: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.451: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.452: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.453: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.454: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.455: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.456: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.457: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.458: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.459: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.460: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.461: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.462: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.463: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.464: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.465: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.466: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.467: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.468: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.469: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.470: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.471: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.472: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.473: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.474: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.475: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.476: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.477: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.478: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.479: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.480: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.481: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.482: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.483: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.484: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.485: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.486: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.487: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4
Source.488: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.489: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.490: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.491: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.492: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.493: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.494: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.495: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.496: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.497: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.498: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.499: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.501: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.502: DFBPPR4558 ---- Plant proteins ---- 40S ribosomal protein S20
Source.503: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15
Source.504: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5
Source.505: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.506: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.507: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.508: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.509: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.510: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.511: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.512: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.513: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.514: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8
Source.515: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.516: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.517: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.518: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.519: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.520: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.521: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.522: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.523: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.524: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.525: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.526: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.527: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.528: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.529: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.530: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.531: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.532: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.533: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.534: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.535: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.536: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.537: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.538: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.539: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.540: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.541: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.542: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.543: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.544: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.545: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.546: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.547: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.548: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.549: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.550: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.551: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.552: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.553: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.554: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.555: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.556: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.557: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.558: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.559: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.560: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.561: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.562: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein
Source.563: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.564: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.565: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.566: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.567: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.568: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1
Source.569: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.570: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.571: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.572: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.573: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.574: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.575: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.576: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.577: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.578: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.579: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.580: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.581: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.582: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.583: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A
Source.584: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.585: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.586: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.587: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.588: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.589: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.590: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.591: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.592: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.593: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.594: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.595: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.596: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.597: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.598: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.599: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.600: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.601: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.602: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.603: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.604: DFBPPR5561 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic
Source.605: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.606: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.607: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.608: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.609: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.610: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.611: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.612: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.613: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.614: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.615: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.616: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.617: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.618: DFBPPR5654 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.619: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.620: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.621: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.622: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.623: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.624: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.625: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.626: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.627: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.628: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.629: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.630: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.631: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.632: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.633: DFBPPR5782 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.634: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.635: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.636: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.637: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.638: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.639: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A
Source.640: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.641: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.642: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.643: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.644: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.645: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.646: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.647: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.648: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.649: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.650: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.651: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.652: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.653: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.654: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.655: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.656: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.657: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.658: DFBPPR6169 ---- Plant proteins ---- Uncharacterized 2.5 kDa protein in tRNA-Arg-tRNA-Asn intergenic region
Source.659: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.660: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.661: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.662: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.663: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.664: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.665: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.666: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.667: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.668: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.669: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.670: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.671: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.672: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.673: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.674: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.675: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.676: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.677: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.678: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.679: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.680: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.681: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.682: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.683: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.684: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.685: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.686: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.687: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.688: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.689: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.690: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.691: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.692: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.693: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.694: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.695: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.696: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.697: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.698: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.699: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.700: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.701: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.702: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.703: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.704: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.705: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.706: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.707: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.708: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.709: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.710: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.711: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.712: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.713: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.714: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.715: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.716: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.717: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.718: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.719: DFBPPR6788 ---- Plant proteins ---- Histone H1
Source.720: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.721: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.722: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.723: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.724: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.725: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.726: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.727: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.728: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.729: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.730: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.731: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.732: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.733: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.734: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.735: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.736: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.737: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.738: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.739: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.740: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.741: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.742: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.743: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.744: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.745: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.746: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.747: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.748: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.749: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.750: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.751: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.752: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.753: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.754: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.755: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.756: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.757: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.758: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.759: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.760: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.761: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.762: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.763: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.764: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.765: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.766: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.767: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.768: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.769: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.770: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.771: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.772: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.773: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.774: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.775: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.776: DFBPPR7478 ---- Plant proteins ---- Napin embryo-specific
Source.777: DFBPPR7482 ---- Plant proteins ---- Napin
Source.778: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.779: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.780: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.781: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.782: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.783: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.784: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.785: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.786: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.787: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.788: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.789: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.790: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.791: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.792: DFBPPR8192 ---- Plant proteins ---- 2S albumin
Source.793: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.794: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.795: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.796: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.797: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.798: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.799: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.800: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.801: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.802: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.803: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.804: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.805: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.806: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.807: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.808: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.809: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.810: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.811: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.812: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.813: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.814: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.815: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.816: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.817: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.818: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.819: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.820: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.821: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.822: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.823: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.824: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.825: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.826: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.827: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.828: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.829: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.830: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.831: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.832: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.833: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.834: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.835: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.836: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.837: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.838: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.839: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.840: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.841: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.842: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.843: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.844: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.845: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.846: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.847: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.848: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.849: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.850: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.851: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.852: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.853: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.854: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.855: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.856: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.857: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.858: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.859: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.860: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.861: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.862: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.863: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.864: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.865: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.866: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.867: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.868: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.869: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.870: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.871: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.872: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.873: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.874: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.875: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.876: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.877: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.878: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.879: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.880: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.881: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.882: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.883: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.884: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.885: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.886: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.887: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.888: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.889: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A
Source.890: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.891: DFBPPR16961 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.892: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.893: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.894: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.895: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.896: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.897: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.898: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.899: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.900: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau
Source.901: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.902: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.903: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.904: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.905: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.906: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.907: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.908: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.909: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.910: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.911: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.912: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.913: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.914: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.915: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.916: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.917: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.918: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.919: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.920: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.921: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.922: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.923: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.924: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.925: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.926: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.927: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.928: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.929: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.930: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.931: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.932: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.933: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.934: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.935: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.936: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.937: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.938: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.939: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.940: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.941: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.942: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.943: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.944: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.945: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.946: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.947: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.948: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.949: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.950: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.951: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.952: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.953: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.954: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.955: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.956: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.957: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.958: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.959: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.960: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A
Source.961: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.962: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.963: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.964: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.965: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.966: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.967: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.968: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.969: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.970: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.971: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.972: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.973: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.974: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.975: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.976: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.977: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.978: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.979: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.980: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.981: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.982: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.983: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.984: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.985: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.986: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.987: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.988: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.989: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.990: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.991: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.992: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.993: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.994: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.995: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.996: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.997: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.998: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.999: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1000: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1001: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.1002: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1003: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.1004: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.1005: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1006: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1007: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.1008: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1009: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.1010: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1011: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1012: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1013: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1014: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.1015: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.1016: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1017: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.1018: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1019: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1020: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.1021: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.1022: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1023: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1024: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1025: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1026: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1027: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.1028: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1029: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.1030: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.1031: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.1032: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1033: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1034: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1035: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1036: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1037: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1038: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.1039: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.1040: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.1041: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.1042: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1043: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1044: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1045: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1046: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.1047: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.1048: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1049: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.1050: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.1051: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.1052: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.1053: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1054: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1055: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1056: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.1057: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.1058: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.1059: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.1060: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1061: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.1062: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1063: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1064: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1065: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.1066: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1067: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.1068: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.1069: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1070: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.1071: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1072: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1073: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1074: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.1075: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.1076: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.1077: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1078: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.1079: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.1080: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.1081: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.1082: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1083: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1084: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1085: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1086: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.1087: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.1088: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.1089: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1090: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1091: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1092: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.1093: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1094: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.1095: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1096: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1097: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1098: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1099: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.1100: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1101: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1102: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.1103: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1104: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.1105: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1106: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.1107: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1108: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1109: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.1110: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.1111: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1112: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.1113: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1114: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1115: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.1116: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.1117: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1118: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1119: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.1120: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.1121: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.1122: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1123: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1124: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.1125: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.1126: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1127: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.1128: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.1129: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2
Source.1130: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.1131: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.1132: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.1133: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1134: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.1135: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1136: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1137: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.1138: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1139: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1140: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.1141: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1142: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1143: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1144: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1145: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.1146: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.1147: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1148: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1149: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.1150: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.1151: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1152: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.1153: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1154: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1155: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1156: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1157: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.1158: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.1159: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1160: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.1161: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.1162: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.1163: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.1164: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1165: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.1166: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1167: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1168: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1169: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.1170: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.1171: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.1172: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.1173: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.1174: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1175: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1176: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1177: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.1178: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1179: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1180: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1181: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1182: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1183: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.1184: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.1185: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.1186: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.1187: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1188: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1189: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1190: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1191: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1192: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1193: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1194: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.1195: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4
Source.1196: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.1197: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.1198: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1199: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1200: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.1201: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1202: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.1203: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1204: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1205: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1206: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1207: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1208: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.1209: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1210: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.1211: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.1212: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.1213: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.1214: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.1215: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.1216: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1217: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1218: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1219: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.1220: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.1221: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1222: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1223: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.1224: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.1225: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.1226: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1227: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.1228: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.1229: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1230: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.1231: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1232: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1233: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.1234: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1235: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1236: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1237: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1238: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.1239: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1240: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1241: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.1242: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1243: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein
Source.1244: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1245: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1246: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1247: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.1248: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.1249: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1250: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.1251: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.1252: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1253: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1254: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1255: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1256: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1257: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1258: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.1259: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.1260: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1261: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1262: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1263: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1264: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.1265: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.1266: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1267: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.1268: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.1269: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1270: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.1271: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1272: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.1273: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1274: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.1275: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.1276: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.1277: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.1278: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1279: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.1280: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.1281: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.1282: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1283: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.1284: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1285: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1286: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1287: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.1288: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1289: DFBPPR20911 ---- Animal proteins ---- 40S ribosomal protein S20
Source.1290: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1291: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2
Source.1292: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.1293: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1294: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1295: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1296: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1297: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.1298: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1299: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1300: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.1301: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.1302: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.1303: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.1304: DFBPPR21207 ---- Animal proteins ---- Ragulator complex protein LAMTOR3
Source.1305: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.1306: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.1307: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.1308: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.1309: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.1310: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.1311: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.1312: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.1313: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.1314: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.1315: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.1316: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.1317: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.1318: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1319: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.1320: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1
Source.1321: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A
Source.1322: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.1323: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.1324: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1325: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1326: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.1327: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.1328: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.1329: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.1330: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.1331: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.1332: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.1333: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1334: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.1335: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.1336: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1337: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.1338: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.1339: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.1340: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.1341: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1342: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1343: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog
Source.1344: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1345: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.1346: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1347: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.1348: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial
Source.1349: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.1350: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1351: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.1352: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1353: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.1354: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1355: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1356: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.1357: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.1358: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.1359: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.1360: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.1361: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.1362: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1363: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.1364: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1365: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1366: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.1367: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.1368: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.1369: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.1370: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1371: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.1372: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.1373: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.1374: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.1375: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.1376: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.1377: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37
Source.1378: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.1379: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.1380: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1381: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.1382: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.1383: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.1384: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.1385: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.1386: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.1387: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.1388: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.1389: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1390: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3
Source.1391: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1392: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1393: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.1394: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.1395: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.1396: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1
Source.1397: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1
Source.1398: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1399: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.1400: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.1401: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.1402: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.1403: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.1404: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.1405: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.1406: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.1407: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.1408: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1409: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.1410: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.1411: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.1412: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.1413: DFBPPR22654 ---- Animal proteins ---- Proline-rich protein 9
Source.1414: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.1415: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.1416: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.1417: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.1418: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.1419: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1420: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1421: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1422: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1423: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.1424: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1425: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1426: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1427: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.1428: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1429: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1430: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1431: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1432: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1433: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1434: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1435: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1436: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1437: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1438: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.1439: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1440: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1441: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1442: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.1443: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1444: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1445: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1446: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1447: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.1448: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1449: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1450: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.1451: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1452: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.1453: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1454: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1455: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.1456: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1457: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.1458: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.1459: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.1460: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.1461: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1462: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1463: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1464: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1465: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.1466: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1467: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1468: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1469: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.1470: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1471: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1472: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.1473: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1474: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.1475: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.1476: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.1477: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.1478: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.1479: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.1480: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1481: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.1482: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.1483: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1484: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1485: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.1486: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1487: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.1488: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.1489: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.1490: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.1491: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1492: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.1493: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1494: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1495: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1496: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.1497: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1498: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.1499: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.1500: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1501: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.1502: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.1503: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.1504: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1505: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1506: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.1507: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.1508: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.1509: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1510: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1511: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.1512: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.1513: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1514: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.1515: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.1516: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1517: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.1518: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.1519: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1520: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1521: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.1522: DFBPPR9612 ---- Animal proteins ---- 40S ribosomal protein S20
Source.1523: DFBPPR9615 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.1524: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.1525: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.1526: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.1527: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.1528: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.1529: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.1530: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.1531: DFBPPR9748 ---- Animal proteins ---- Involucrin
Source.1532: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.1533: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1534: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.1535: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1536: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.1537: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1538: DFBPPR9843 ---- Animal proteins ---- P protein
Source.1539: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.1540: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.1541: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1542: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1543: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1544: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.1545: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1546: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1547: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.1548: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.1549: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1550: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1551: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.1552: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.1553: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1554: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.1555: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1556: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.1557: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1558: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.1559: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.1560: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1561: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.1562: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1563: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1564: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.1565: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.1566: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1567: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.1568: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.1569: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1570: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.1571: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1572: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.1573: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2
Source.1574: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.1575: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.1576: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.1577: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1578: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.1579: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1580: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1581: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1582: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1583: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.1584: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1585: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.1586: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1587: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1588: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1589: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.1590: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.1591: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1592: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1593: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1594: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.1595: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1596: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.1597: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1598: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1599: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1600: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1601: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.1602: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.1603: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1604: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1605: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.1606: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1607: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1608: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1609: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1610: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.1611: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.1612: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.1613: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1614: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1615: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1616: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1617: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.1618: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1619: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.1620: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.1621: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1622: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1623: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1624: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.1625: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1626: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1627: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.1628: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.1629: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.1630: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.1631: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.1632: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1633: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.1634: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.1635: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1636: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1637: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1638: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.1639: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1640: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1641: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.1642: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1643: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.1644: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.1645: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1646: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1647: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1648: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1649: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.1650: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1651: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1652: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.1653: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.1654: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.1655: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.1656: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.1657: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.1658: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1659: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.1660: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1661: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.1662: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.1663: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.1664: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1665: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.1666: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1667: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1668: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1669: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1670: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1671: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.1672: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1673: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1674: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.1675: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1676: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.1677: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1678: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.1679: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.1680: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1681: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.1682: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.1683: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1684: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1685: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.1686: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1687: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.1688: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1689: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1690: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.1691: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1692: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1693: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1694: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.1695: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1696: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.1697: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1698: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.1699: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1700: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1701: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1702: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.1703: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.1704: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1705: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.1706: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1707: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.1708: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1709: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.1710: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.1711: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.1712: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1713: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1714: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1715: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1716: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1717: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.1718: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.1719: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1
Source.1720: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1721: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1722: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.1723: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1724: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.1725: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1726: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.1727: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1728: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.1729: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.1730: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.1731: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1732: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.1733: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.1734: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.1735: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1736: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.1737: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.1738: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1739: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.1740: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.1741: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.1742: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1743: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.1744: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.1745: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.1746: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.1747: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.1748: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.1749: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.1750: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.1751: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1752: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1753: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1754: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1755: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1756: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.1757: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1758: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1759: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.1760: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1761: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1762: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1763: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1764: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.1765: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.1766: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.1767: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.1768: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1769: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1770: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.1771: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.1772: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.1773: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.1774: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1775: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1776: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.1777: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.1778: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.1779: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1780: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.1781: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.1782: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.1783: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1784: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1785: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.1786: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.1787: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.1788: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.1789: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.1790: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.1791: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.1792: DFBPPR12047 ---- Animal proteins ---- Ragulator complex protein LAMTOR3
Source.1793: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.1794: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.1795: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.1796: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1797: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.1798: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.1799: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.1800: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1801: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.1802: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.1803: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1804: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1805: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.1806: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.1807: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.1808: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1809: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.1810: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.1811: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1812: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.1813: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1814: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1815: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.1816: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1817: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.1818: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.1819: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1820: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1821: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1822: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1823: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.1824: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1825: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.1826: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1827: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1828: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1829: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1830: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1831: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1832: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.1833: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1834: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1835: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1836: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.1837: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1838: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1839: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1840: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.1841: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.1842: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.1843: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1844: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.1845: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1846: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1847: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1848: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1849: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1850: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1851: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1852: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.1853: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.1854: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1855: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1856: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.1857: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor
Source.1858: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.1859: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1860: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle
Source.1861: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1862: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.1863: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1864: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1865: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.1866: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1867: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.1868: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1869: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1870: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1871: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1872: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.1873: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.1874: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1875: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1876: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1877: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.1878: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.1879: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1880: DFBPPR12875 ---- Animal proteins ---- Fatty acid synthase
Source.1881: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.1882: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.1883: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1884: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.1885: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.1886: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1887: DFBPPR12939 ---- Animal proteins ---- Gastrotropin
Source.1888: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1889: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1890: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.1891: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1892: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.1893: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.1894: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.1895: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.1896: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.1897: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1898: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.1899: DFBPPR13104 ---- Animal proteins ---- Ig kappa chain V region 2717
Source.1900: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1901: DFBPPR13118 ---- Animal proteins ---- Ig kappa-B5 chain V region 2699
Source.1902: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.1903: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1904: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.1905: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.1906: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.1907: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1908: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1909: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.1910: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1911: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1912: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.1913: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.1914: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.1915: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.1916: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.1917: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.1918: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1919: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1920: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.1921: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.1922: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1923: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1924: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1925: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.1926: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.1927: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.1928: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1929: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.1930: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.1931: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau
Source.1932: DFBPPR13456 ---- Animal proteins ---- Galectin-1
Source.1933: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.1934: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1935: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1936: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1937: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1938: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.1939: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1940: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1941: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1942: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1943: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1944: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.1945: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.1946: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1947: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1948: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1949: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.1950: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1951: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1952: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1953: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1954: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.1955: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.1956: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.1957: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.1958: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.1959: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.1960: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.1961: DFBPPR13925 ---- Animal proteins ---- Homeobox protein BarH-like 2
Source.1962: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1963: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1964: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1965: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z
Source.1966: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.1967: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1968: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.1969: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.1970: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.1971: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.1972: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.1973: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.1974: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.1975: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.1976: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.1977: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.1978: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.1979: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.1980: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.1981: DFBPPR14245 ---- Marine protein ---- Pro-MCH 1
Source.1982: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.1983: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.1984: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.1985: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1986: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1987: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.1988: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.1989: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1990: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.1991: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.1992: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.1993: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.1994: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.1995: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.1996: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.1997: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.1998: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.1999: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2000: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.2001: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.2002: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.2003: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1
Source.2004: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.2005: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.2006: DFBPPR14727 ---- Marine protein ---- Cytochrome c oxidase polypeptide 4, mitochondrial
Source.2007: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2008: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.2009: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.2010: DFBPPR14783 ---- Marine protein ---- Enolase
Source.2011: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2012: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.2013: DFBPPR14854 ---- Marine protein ---- Fucolectin
Source.2014: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2015: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.2016: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.2017: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.2018: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.2019: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.2020: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.2021: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.2022: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.2023: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.2024: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.2025: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.2026: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2027: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.2028: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.2029: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2030: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.2031: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.2032: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2033: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2034: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2035: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.2036: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2037: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.2038: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.2039: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.2040: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.2041: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.2042: DFBPPR15062 ---- Microorganism protein ---- Transcription and mRNA export factor SUS1
Source.2043: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2044: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.2045: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.2046: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.2047: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.2048: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2049: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.2050: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.2051: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.2052: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.2053: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2054: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.2055: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.2056: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.2057: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2058: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2059: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.2060: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.2061: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.2062: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.2063: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.2064: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2065: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.2066: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.2067: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.2068: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2
Source.2069: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.2070: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.2071: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.2072: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.2073: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.2074: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.2075: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.2076: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2077: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.2078: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.2079: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2080: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.2081: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.2082: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.2083: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.2084: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.2085: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.2086: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.2087: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.2088: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.2089: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.2090: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.2091: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.2092: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.2093: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2094: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.2095: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.2096: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.2097: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.2098: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1
Source.2099: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.2100: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.2101: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.2102: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.2103: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.2104: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.2105: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.2106: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.2107: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14
Source.2108: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.2109: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.2110: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.2111: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.2112: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.2113: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.2114: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.2115: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.2116: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2117: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2118: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.2119: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.2120: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2121: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.2122: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.2123: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.2124: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.2125: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2126: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2127: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.2128: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.2129: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.2130: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.2131: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.2132: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.2133: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.2134: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2135: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2136: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2137: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.2138: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.2139: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.2140: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.2141: DFBPPR7967 ---- Plant protein ---- Plastocyanin
Source.2142: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.2143: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.2144: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2145: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.2146: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2147: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.2148: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.2149: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2150: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2151: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2152: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.2153: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2154: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.2155: DFBPPR8212 ---- Plant protein ---- Trypsin inhibitor 1
Source.2156: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.2157: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.2158: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2159: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2160: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2161: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.2162: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
Link 1: DFBPACEI1181----Pearl oyster (Pinctada fucata martensii)----Pearl oyster powder hydrolysates
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 115.20 uM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydroysis

Enzyme(s)/starter culture

Wheat germ was hydrolyzed with an incubation medium to activate wheat germ endogenous proteases for degrading its own storage protein to hypotensive peptides (pH 4.4 with a liquid to solid ratio 8.14 mL/g at temperature 47 ℃, for 7 h).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPANHY0846
[D2] DFBPMUFU0238
BIOPEP-UWM [D3] -
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Yang R, Zou Y, Yu N, Gu Z. Accumulation and identification of angiotensin-converting enzyme inhibitory peptides from wheat germ. J Agric Food Chem. 2011 Apr 27;59(8):3598-605.
PMID: 21381782
Other literature(s) N.D
PubDate 2011
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214